C15H20FNO3 — CID 64597987
1-(3-fluoro-4-methoxyphenyl)-2-[3-(methoxymethyl)pyrrolidin-1-yl]ethanone (PubChem CID 64597987) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-2-[3-(methoxymethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-2-[3-(methoxymethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 64597987 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-2-[3-(methoxymethyl)pyrrolidin-1-yl]ethanone |
| SMILES | COCC1CCN(CC(=O)c2ccc(OC)c(F)c2)C1 |
| InChI | InChI=1S/C15H20FNO3/c1-19-10-11-5-6-17(8-11)9-14(18)12-3-4-15(20-2)13(16)7-12/h3-4,7,11H,5-6,8-10H2,1-2H3 |
| InChIKey | PLRQICNASQXRFQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |