About 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide
3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 64598722) has the molecular formula C13H22N4S
and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide.
Molecular Properties
| Compound Name | 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide |
| PubChem CID | 64598722 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(NCC(C)C(C)C)c(C(N)=S)c1C |
| InChI | InChI=1S/C13H22N4S/c1-7(2)8(3)6-15-13-11(12(14)18)9(4)10(5)16-17-13/h7-8H,6H2,1-5H3,(H2,14,18)(H,15,17) |
| InChIKey | OPQAXLDKPSQPMB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide?
The IUPAC name of 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide (CID 64598722) is 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide.
What is the SMILES notation for 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide?
The canonical SMILES for 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide is Cc1nnc(NCC(C)C(C)C)c(C(N)=S)c1C.
What is the InChIKey of 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide?
The InChIKey is OPQAXLDKPSQPMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4S/c1-7(2)8(3)6-15-13-11(12(14)18)9(4)10(5)16-17-13/h7-8H,6H2,1-5H3,(H2,14,18)(H,15,17).
What are the key properties of 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide?
3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide has a molecular weight of 266.41 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylbutylamino)-5,6-dimethylpyridazine-4-carbothioamide is sourced from PubChem (CID 64598722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).