C13H28N2 — CID 64598761
3-[(2,3-dimethylbutylamino)methyl]cyclohexan-1-amine (PubChem CID 64598761) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 3-[(2,3-dimethylbutylamino)methyl]cyclohexan-1-amine.
| Compound Name | 3-[(2,3-dimethylbutylamino)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 64598761 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 3-[(2,3-dimethylbutylamino)methyl]cyclohexan-1-amine |
| SMILES | CC(C)C(C)CNCC1CCCC(N)C1 |
| InChI | InChI=1S/C13H28N2/c1-10(2)11(3)8-15-9-12-5-4-6-13(14)7-12/h10-13,15H,4-9,14H2,1-3H3 |
| InChIKey | FYNQGFFANWOIRR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |