C16H20N2O2 — CID 64599052
[1-[3-(methoxymethyl)pyrrolidin-1-yl]isoquinolin-3-yl]methanol (PubChem CID 64599052) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is [1-[3-(methoxymethyl)pyrrolidin-1-yl]isoquinolin-3-yl]methanol.
| Compound Name | [1-[3-(methoxymethyl)pyrrolidin-1-yl]isoquinolin-3-yl]methanol |
|---|---|
| PubChem CID | 64599052 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [1-[3-(methoxymethyl)pyrrolidin-1-yl]isoquinolin-3-yl]methanol |
| SMILES | COCC1CCN(c2nc(CO)cc3ccccc23)C1 |
| InChI | InChI=1S/C16H20N2O2/c1-20-11-12-6-7-18(9-12)16-15-5-3-2-4-13(15)8-14(10-19)17-16/h2-5,8,12,19H,6-7,9-11H2,1H3 |
| InChIKey | HYECPMAFKUEZGG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |