C9H16N2S — CID 64599410
3-(2,3-dimethylbutyl)-1H-imidazole-2-thione (PubChem CID 64599410) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 3-(2,3-dimethylbutyl)-1H-imidazole-2-thione.
| Compound Name | 3-(2,3-dimethylbutyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 64599410 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-(2,3-dimethylbutyl)-1H-imidazole-2-thione |
| SMILES | CC(C)C(C)Cn1cc[nH]c1=S |
| InChI | InChI=1S/C9H16N2S/c1-7(2)8(3)6-11-5-4-10-9(11)12/h4-5,7-8H,6H2,1-3H3,(H,10,12) |
| InChIKey | MITZJMNOJSREPC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|