C8H15NO3 — CID 64599596
2-[3-(methoxymethyl)pyrrolidin-1-yl]acetic acid (PubChem CID 64599596) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-[3-(methoxymethyl)pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[3-(methoxymethyl)pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 64599596 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-[3-(methoxymethyl)pyrrolidin-1-yl]acetic acid |
| SMILES | COCC1CCN(CC(=O)O)C1 |
| InChI | InChI=1S/C8H15NO3/c1-12-6-7-2-3-9(4-7)5-8(10)11/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | VGQPFDICEPFSME-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |