C15H17ClN2O2 — CID 64601067
N-[[4-[(5-chloro-3-pyridinyl)oxymethyl]-5-methylfuran-2-yl]methyl]cyclopropanamine (PubChem CID 64601067) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is N-[[4-[(5-chloro-3-pyridinyl)oxymethyl]-5-methylfuran-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-[(5-chloro-3-pyridinyl)oxymethyl]-5-methylfuran-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 64601067 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[[4-[(5-chloro-3-pyridinyl)oxymethyl]-5-methylfuran-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1oc(CNC2CC2)cc1COc1cncc(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-10-11(4-15(20-10)8-18-13-2-3-13)9-19-14-5-12(16)6-17-7-14/h4-7,13,18H,2-3,8-9H2,1H3 |
| InChIKey | ULNQSEZCHZNUQS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |