C16H14FN3O2 — CID 6460126
1-(4-fluorophenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide (PubChem CID 6460126) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 6460126 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(4-fluorophenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H14FN3O2/c17-12-3-5-14(6-4-12)20-10-11(8-15(20)21)16(22)19-13-2-1-7-18-9-13/h1-7,9,11H,8,10H2,(H,19,22) |
| InChIKey | LAHDIYSJYSYHHF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |