About N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide
N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide (PubChem CID 6460162) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide |
| PubChem CID | 6460162 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2nc(-c3ccccc3C)oc2c1 |
| InChI | InChI=1S/C16H14N2O2/c1-10-5-3-4-6-13(10)16-18-14-8-7-12(17-11(2)19)9-15(14)20-16/h3-9H,1-2H3,(H,17,19) |
| InChIKey | VUVMYRDCVBBYLA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide?
The IUPAC name of N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide (CID 6460162) is N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide.
What is the SMILES notation for N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide?
The canonical SMILES for N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide is CC(=O)Nc1ccc2nc(-c3ccccc3C)oc2c1.
What is the InChIKey of N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide?
The InChIKey is VUVMYRDCVBBYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c1-10-5-3-4-6-13(10)16-18-14-8-7-12(17-11(2)19)9-15(14)20-16/h3-9H,1-2H3,(H,17,19).
What are the key properties of N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide?
N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide has a molecular weight of 266.30 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]acetamide is sourced from PubChem (CID 6460162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).