C11H16ClN3O3S — CID 64601682
6-amino-5-chloro-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 64601682) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64601682 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 6-amino-5-chloro-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | Nc1ncc(S(=O)(=O)NCC2CCCOC2)cc1Cl |
| InChI | InChI=1S/C11H16ClN3O3S/c12-10-4-9(6-14-11(10)13)19(16,17)15-5-8-2-1-3-18-7-8/h4,6,8,15H,1-3,5,7H2,(H2,13,14) |
| InChIKey | KXEUOQMMTHIHLJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |