About 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine
3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine (PubChem CID 64602066) has the molecular formula C12H18ClN3O3S
and a molecular weight of 319.81 g/mol. Its IUPAC name is 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine |
| PubChem CID | 64602066 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine |
| SMILES | CC1CN(S(=O)(=O)c2cnc(N)c(Cl)c2)CC(C)(C)O1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-8-6-16(7-12(2,3)19-8)20(17,18)9-4-10(13)11(14)15-5-9/h4-5,8H,6-7H2,1-3H3,(H2,14,15) |
| InChIKey | CZCSNRKPZKDSDS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine?
The IUPAC name of 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine (CID 64602066) is 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine.
What is the SMILES notation for 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine?
The canonical SMILES for 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine is CC1CN(S(=O)(=O)c2cnc(N)c(Cl)c2)CC(C)(C)O1.
What is the InChIKey of 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine?
The InChIKey is CZCSNRKPZKDSDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3O3S/c1-8-6-16(7-12(2,3)19-8)20(17,18)9-4-10(13)11(14)15-5-9/h4-5,8H,6-7H2,1-3H3,(H2,14,15).
What are the key properties of 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine?
3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine has a molecular weight of 319.81 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridin-2-amine is sourced from PubChem (CID 64602066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).