C13H13Cl2N3O2S — CID 64602441
6-amino-5-chloro-N-[(3-chlorophenyl)methyl]-N-methylpyridine-3-sulfonamide (PubChem CID 64602441) has the molecular formula C13H13Cl2N3O2S and a molecular weight of 346.24 g/mol. Its IUPAC name is 6-amino-5-chloro-N-[(3-chlorophenyl)methyl]-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-[(3-chlorophenyl)methyl]-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64602441 |
| Molecular Formula | C13H13Cl2N3O2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 6-amino-5-chloro-N-[(3-chlorophenyl)methyl]-N-methylpyridine-3-sulfonamide |
| SMILES | CN(Cc1cccc(Cl)c1)S(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3O2S/c1-18(8-9-3-2-4-10(14)5-9)21(19,20)11-6-12(15)13(16)17-7-11/h2-7H,8H2,1H3,(H2,16,17) |
| InChIKey | DPCRGNJGOLBYAJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |