About 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole
1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole (PubChem CID 64604508) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole |
| PubChem CID | 64604508 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole |
| SMILES | COCCC(C)n1c(C)ccc1C |
| InChI | InChI=1S/C11H19NO/c1-9-5-6-10(2)12(9)11(3)7-8-13-4/h5-6,11H,7-8H2,1-4H3 |
| InChIKey | CPKNXWOWIXVSOY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole?
The IUPAC name of 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole (CID 64604508) is 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole.
What is the SMILES notation for 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole?
The canonical SMILES for 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole is COCCC(C)n1c(C)ccc1C.
What is the InChIKey of 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole?
The InChIKey is CPKNXWOWIXVSOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-9-5-6-10(2)12(9)11(3)7-8-13-4/h5-6,11H,7-8H2,1-4H3.
What are the key properties of 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole?
1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole has a molecular weight of 181.28 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxybutan-2-yl)-2,5-dimethylpyrrole is sourced from PubChem (CID 64604508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).