C13H14FNO4 — CID 64604597
2-[1-[2-(2-fluorophenoxy)acetyl]azetidin-3-yl]acetic acid (PubChem CID 64604597) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is 2-[1-[2-(2-fluorophenoxy)acetyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(2-fluorophenoxy)acetyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64604597 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[1-[2-(2-fluorophenoxy)acetyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)COc2ccccc2F)C1 |
| InChI | InChI=1S/C13H14FNO4/c14-10-3-1-2-4-11(10)19-8-12(16)15-6-9(7-15)5-13(17)18/h1-4,9H,5-8H2,(H,17,18) |
| InChIKey | ORIJYONQQPGOFK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |