About 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine
4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine (PubChem CID 64605125) has the molecular formula C12H18N6O
and a molecular weight of 262.32 g/mol. Its IUPAC name is 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine |
| PubChem CID | 64605125 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine |
| SMILES | COCCC(C)n1nnnc1-c1ccc(N)cc1N |
| InChI | InChI=1S/C12H18N6O/c1-8(5-6-19-2)18-12(15-16-17-18)10-4-3-9(13)7-11(10)14/h3-4,7-8H,5-6,13-14H2,1-2H3 |
| InChIKey | ZUQKTDABZDWJGO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine?
The IUPAC name of 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine (CID 64605125) is 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine.
What is the SMILES notation for 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine?
The canonical SMILES for 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine is COCCC(C)n1nnnc1-c1ccc(N)cc1N.
What is the InChIKey of 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine?
The InChIKey is ZUQKTDABZDWJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6O/c1-8(5-6-19-2)18-12(15-16-17-18)10-4-3-9(13)7-11(10)14/h3-4,7-8H,5-6,13-14H2,1-2H3.
What are the key properties of 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine?
4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine has a molecular weight of 262.32 g/mol, XLogP of 1.10, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-methoxybutan-2-yl)tetrazol-5-yl]benzene-1,3-diamine is sourced from PubChem (CID 64605125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).