About 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide
2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide (PubChem CID 646068) has the molecular formula C16H21N5OS
and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide |
| PubChem CID | 646068 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide |
| SMILES | Nn1cnnc1SCC(=O)Nc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H21N5OS/c17-21-11-18-20-16(21)23-10-15(22)19-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-9,11-12H,1-5,10,17H2,(H,19,22) |
| InChIKey | ARPAKTGFQWWJDV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide?
The IUPAC name of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide (CID 646068) is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide.
What is the SMILES notation for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide?
The canonical SMILES for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide is Nn1cnnc1SCC(=O)Nc1ccc(C2CCCCC2)cc1.
What is the InChIKey of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide?
The InChIKey is ARPAKTGFQWWJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5OS/c17-21-11-18-20-16(21)23-10-15(22)19-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-9,11-12H,1-5,10,17H2,(H,19,22).
What are the key properties of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide?
2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide has a molecular weight of 331.45 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-N-(4-cyclohexylphenyl)acetamide is sourced from PubChem (CID 646068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).