About N-(4-oxo-1,3-benzothiazin-2-yl)acetamide
N-(4-oxo-1,3-benzothiazin-2-yl)acetamide (PubChem CID 646071) has the molecular formula C10H8N2O2S
and a molecular weight of 220.25 g/mol. Its IUPAC name is N-(4-oxo-1,3-benzothiazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-oxo-1,3-benzothiazin-2-yl)acetamide |
| PubChem CID | 646071 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | N-(4-oxo-1,3-benzothiazin-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C10H8N2O2S/c1-6(13)11-10-12-9(14)7-4-2-3-5-8(7)15-10/h2-5H,1H3,(H,11,12,13,14) |
| InChIKey | IWJVWMRNUZDTCR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-oxo-1,3-benzothiazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-oxo-1,3-benzothiazin-2-yl)acetamide?
The IUPAC name of N-(4-oxo-1,3-benzothiazin-2-yl)acetamide (CID 646071) is N-(4-oxo-1,3-benzothiazin-2-yl)acetamide.
What is the SMILES notation for N-(4-oxo-1,3-benzothiazin-2-yl)acetamide?
The canonical SMILES for N-(4-oxo-1,3-benzothiazin-2-yl)acetamide is CC(=O)Nc1nc(=O)c2ccccc2s1.
What is the InChIKey of N-(4-oxo-1,3-benzothiazin-2-yl)acetamide?
The InChIKey is IWJVWMRNUZDTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S/c1-6(13)11-10-12-9(14)7-4-2-3-5-8(7)15-10/h2-5H,1H3,(H,11,12,13,14).
What are the key properties of N-(4-oxo-1,3-benzothiazin-2-yl)acetamide?
N-(4-oxo-1,3-benzothiazin-2-yl)acetamide has a molecular weight of 220.25 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-oxo-1,3-benzothiazin-2-yl)acetamide is sourced from PubChem (CID 646071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).