About 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide
5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide (PubChem CID 64608618) has the molecular formula C10H14Cl2N2O4S
and a molecular weight of 329.21 g/mol. Its IUPAC name is 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide |
| PubChem CID | 64608618 |
| Molecular Formula | C10H14Cl2N2O4S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide |
| SMILES | COC(OC)C(C)NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O4S/c1-6(10(17-2)18-3)14-19(15,16)7-4-8(11)9(12)13-5-7/h4-6,10,14H,1-3H3 |
| InChIKey | FQOTYXWVLLGXAU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide?
The IUPAC name of 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide (CID 64608618) is 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide.
What is the SMILES notation for 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide?
The canonical SMILES for 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide is COC(OC)C(C)NS(=O)(=O)c1cnc(Cl)c(Cl)c1.
What is the InChIKey of 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide?
The InChIKey is FQOTYXWVLLGXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N2O4S/c1-6(10(17-2)18-3)14-19(15,16)7-4-8(11)9(12)13-5-7/h4-6,10,14H,1-3H3.
What are the key properties of 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide?
5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide has a molecular weight of 329.21 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-N-(1,1-dimethoxypropan-2-yl)pyridine-3-sulfonamide is sourced from PubChem (CID 64608618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).