About N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine
N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine (PubChem CID 64609666) has the molecular formula C14H29NS
and a molecular weight of 243.46 g/mol. Its IUPAC name is N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine |
| PubChem CID | 64609666 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine |
| SMILES | CCNC1CCC(C)(C)CC1SCC(C)C |
| InChI | InChI=1S/C14H29NS/c1-6-15-12-7-8-14(4,5)9-13(12)16-10-11(2)3/h11-13,15H,6-10H2,1-5H3 |
| InChIKey | JPAXCQCEMOCRSW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine?
The IUPAC name of N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine (CID 64609666) is N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine.
What is the SMILES notation for N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine?
The canonical SMILES for N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine is CCNC1CCC(C)(C)CC1SCC(C)C.
What is the InChIKey of N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine?
The InChIKey is JPAXCQCEMOCRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NS/c1-6-15-12-7-8-14(4,5)9-13(12)16-10-11(2)3/h11-13,15H,6-10H2,1-5H3.
What are the key properties of N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine?
N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine has a molecular weight of 243.46 g/mol, XLogP of 3.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4-dimethyl-2-(2-methylpropylsulfanyl)cyclohexan-1-amine is sourced from PubChem (CID 64609666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).