About N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide
N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide (PubChem CID 646097) has the molecular formula C16H12N2O3S
and a molecular weight of 312.35 g/mol. Its IUPAC name is N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide |
| PubChem CID | 646097 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide |
| SMILES | O=C(Cn1ccs/c1=N\C(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O3S/c19-13(12-5-2-1-3-6-12)11-18-8-10-22-16(18)17-15(20)14-7-4-9-21-14/h1-10H,11H2/b17-16- |
| InChIKey | VTWGHLRFLCGOAD-MSUUIHNZSA-N |
| XLogP | 2.77 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide?
The IUPAC name of N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide (CID 646097) is N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide.
What is the SMILES notation for N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide?
The canonical SMILES for N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide is O=C(Cn1ccs/c1=N\C(=O)c1ccco1)c1ccccc1.
What is the InChIKey of N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide?
The InChIKey is VTWGHLRFLCGOAD-MSUUIHNZSA-N. The full InChI is InChI=1S/C16H12N2O3S/c19-13(12-5-2-1-3-6-12)11-18-8-10-22-16(18)17-15(20)14-7-4-9-21-14/h1-10H,11H2/b17-16-.
What are the key properties of N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide?
N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide has a molecular weight of 312.35 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-phenacyl-1,3-thiazol-2-ylidene)furan-2-carboxamide is sourced from PubChem (CID 646097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).