C15H21NO3S — CID 6461037
N-cyclopentyl-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 6461037) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-cyclopentyl-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-cyclopentyl-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 6461037 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-cyclopentyl-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C15H21NO3S/c1-12-6-8-14(9-7-12)20(18,19)11-10-15(17)16-13-4-2-3-5-13/h6-9,13H,2-5,10-11H2,1H3,(H,16,17) |
| InChIKey | GJLKMKHMCLZMGL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |