C13H20ClNO3 — CID 6461052
N-[(2,4,5-trimethoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 6461052) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is N-[(2,4,5-trimethoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[(2,4,5-trimethoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 6461052 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[(2,4,5-trimethoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cc(OC)c(OC)cc1OC.Cl |
| InChI | InChI=1S/C13H19NO3.ClH/c1-5-6-14-9-10-7-12(16-3)13(17-4)8-11(10)15-2;/h5,7-8,14H,1,6,9H2,2-4H3;1H |
| InChIKey | ZAZMIAGGEIZVPE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|