About methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate
methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate (PubChem CID 64613951) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate |
| PubChem CID | 64613951 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate |
| SMILES | COC(=O)CSC1CC(C)(C)CCC1N |
| InChI | InChI=1S/C11H21NO2S/c1-11(2)5-4-8(12)9(6-11)15-7-10(13)14-3/h8-9H,4-7,12H2,1-3H3 |
| InChIKey | WPMWZNOPIYQCSP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate?
The IUPAC name of methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate (CID 64613951) is methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate.
What is the SMILES notation for methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate?
The canonical SMILES for methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate is COC(=O)CSC1CC(C)(C)CCC1N.
What is the InChIKey of methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate?
The InChIKey is WPMWZNOPIYQCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-11(2)5-4-8(12)9(6-11)15-7-10(13)14-3/h8-9H,4-7,12H2,1-3H3.
What are the key properties of methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate?
methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate has a molecular weight of 231.36 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-amino-5,5-dimethylcyclohexyl)sulfanylacetate is sourced from PubChem (CID 64613951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).