C15H25NS — CID 64614076
1-(2,5-dimethylphenyl)-N-ethyl-2-propylsulfanylethanamine (PubChem CID 64614076) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-ethyl-2-propylsulfanylethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-ethyl-2-propylsulfanylethanamine |
|---|---|
| PubChem CID | 64614076 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-ethyl-2-propylsulfanylethanamine |
| SMILES | CCCSCC(NCC)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H25NS/c1-5-9-17-11-15(16-6-2)14-10-12(3)7-8-13(14)4/h7-8,10,15-16H,5-6,9,11H2,1-4H3 |
| InChIKey | RNBKRIJNOWMHJS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|