C12H17F2NS — CID 64614516
1-(3,4-difluorophenyl)sulfanyl-N-methylpentan-2-amine (PubChem CID 64614516) has the molecular formula C12H17F2NS and a molecular weight of 245.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfanyl-N-methylpentan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)sulfanyl-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 64614516 |
| Molecular Formula | C12H17F2NS |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfanyl-N-methylpentan-2-amine |
| SMILES | CCCC(CSc1ccc(F)c(F)c1)NC |
| InChI | InChI=1S/C12H17F2NS/c1-3-4-9(15-2)8-16-10-5-6-11(13)12(14)7-10/h5-7,9,15H,3-4,8H2,1-2H3 |
| InChIKey | BNHIJYBBNGMKBY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |