C12H16BrNS — CID 64614964
2-(2-bromophenyl)sulfanylcyclohexan-1-amine (PubChem CID 64614964) has the molecular formula C12H16BrNS and a molecular weight of 286.24 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanylcyclohexan-1-amine.
| Compound Name | 2-(2-bromophenyl)sulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64614964 |
| Molecular Formula | C12H16BrNS |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-(2-bromophenyl)sulfanylcyclohexan-1-amine |
| SMILES | NC1CCCCC1Sc1ccccc1Br |
| InChI | InChI=1S/C12H16BrNS/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1,3,5,7,10,12H,2,4,6,8,14H2 |
| InChIKey | IPZXHRJGGLRGLN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |