C12H15F2NS — CID 64615360
2-(3,4-difluorophenyl)sulfanylcyclohexan-1-amine (PubChem CID 64615360) has the molecular formula C12H15F2NS and a molecular weight of 243.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanylcyclohexan-1-amine.
| Compound Name | 2-(3,4-difluorophenyl)sulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64615360 |
| Molecular Formula | C12H15F2NS |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanylcyclohexan-1-amine |
| SMILES | NC1CCCCC1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2NS/c13-9-6-5-8(7-10(9)14)16-12-4-2-1-3-11(12)15/h5-7,11-12H,1-4,15H2 |
| InChIKey | GFHVGMXHMHFABF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |