About [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate
[2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 646158) has the molecular formula C20H21N3O3S
and a molecular weight of 383.47 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 646158 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | Cn1c(C(=O)OC(C(=O)NC2CCCC2)c2cccnc2)cc2sccc21 |
| InChI | InChI=1S/C20H21N3O3S/c1-23-15-8-10-27-17(15)11-16(23)20(25)26-18(13-5-4-9-21-12-13)19(24)22-14-6-2-3-7-14/h4-5,8-12,14,18H,2-3,6-7H2,1H3,(H,22,24) |
| InChIKey | IAPDTBGWRYTTBA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate (CID 646158) is [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate is Cn1c(C(=O)OC(C(=O)NC2CCCC2)c2cccnc2)cc2sccc21.
What is the InChIKey of [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate?
The InChIKey is IAPDTBGWRYTTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3S/c1-23-15-8-10-27-17(15)11-16(23)20(25)26-18(13-5-4-9-21-12-13)19(24)22-14-6-2-3-7-14/h4-5,8-12,14,18H,2-3,6-7H2,1H3,(H,22,24).
What are the key properties of [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate?
[2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate has a molecular weight of 383.47 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl] 4-methylthieno[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 646158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).