C17H22ClNO — CID 6462036
N-[(2-ethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride (PubChem CID 6462036) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 6462036 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride |
| SMILES | CCOc1ccccc1CNCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C17H21NO.ClH/c1-3-19-17-7-5-4-6-16(17)13-18-12-15-10-8-14(2)9-11-15;/h4-11,18H,3,12-13H2,1-2H3;1H |
| InChIKey | DJRWJPANJNSGTL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |