About N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine
N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine (PubChem CID 64620627) has the molecular formula C8H16N4S
and a molecular weight of 200.31 g/mol. Its IUPAC name is N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine |
| PubChem CID | 64620627 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine |
| SMILES | CCNC(C)C(C)Sc1ncn[nH]1 |
| InChI | InChI=1S/C8H16N4S/c1-4-9-6(2)7(3)13-8-10-5-11-12-8/h5-7,9H,4H2,1-3H3,(H,10,11,12) |
| InChIKey | PIOMMZWQIIOJLY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine?
The IUPAC name of N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine (CID 64620627) is N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine.
What is the SMILES notation for N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine?
The canonical SMILES for N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine is CCNC(C)C(C)Sc1ncn[nH]1.
What is the InChIKey of N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine?
The InChIKey is PIOMMZWQIIOJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4S/c1-4-9-6(2)7(3)13-8-10-5-11-12-8/h5-7,9H,4H2,1-3H3,(H,10,11,12).
What are the key properties of N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine?
N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine has a molecular weight of 200.31 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)butan-2-amine is sourced from PubChem (CID 64620627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).