About butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate
butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate (PubChem CID 646212) has the molecular formula C12H14N4O3S
and a molecular weight of 294.34 g/mol. Its IUPAC name is butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate.
Molecular Properties
| Compound Name | butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate |
| PubChem CID | 646212 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate |
| SMILES | CCC(C)OC(=O)n1ccc(C(=O)Nc2nccs2)n1 |
| InChI | InChI=1S/C12H14N4O3S/c1-3-8(2)19-12(18)16-6-4-9(15-16)10(17)14-11-13-5-7-20-11/h4-8H,3H2,1-2H3,(H,13,14,17) |
| InChIKey | VBEFKKAUPMBZSB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate?
The IUPAC name of butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate (CID 646212) is butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate.
What is the SMILES notation for butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate?
The canonical SMILES for butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate is CCC(C)OC(=O)n1ccc(C(=O)Nc2nccs2)n1.
What is the InChIKey of butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate?
The InChIKey is VBEFKKAUPMBZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3S/c1-3-8(2)19-12(18)16-6-4-9(15-16)10(17)14-11-13-5-7-20-11/h4-8H,3H2,1-2H3,(H,13,14,17).
What are the key properties of butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate?
butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate has a molecular weight of 294.34 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 3-(1,3-thiazol-2-ylcarbamoyl)pyrazole-1-carboxylate is sourced from PubChem (CID 646212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).