C16H18FNO2S — CID 64621439
1-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)sulfanylethanamine (PubChem CID 64621439) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)sulfanylethanamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 64621439 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)sulfanylethanamine |
| SMILES | COc1ccc(OC)c(C(N)CSc2ccccc2F)c1 |
| InChI | InChI=1S/C16H18FNO2S/c1-19-11-7-8-15(20-2)12(9-11)14(18)10-21-16-6-4-3-5-13(16)17/h3-9,14H,10,18H2,1-2H3 |
| InChIKey | OMZONCWMPXGYLD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |