About N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine
N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine (PubChem CID 64622047) has the molecular formula C19H31NS
and a molecular weight of 305.53 g/mol. Its IUPAC name is N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine |
| PubChem CID | 64622047 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine |
| SMILES | CCNC1CCC(C)(C)CC1Sc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H31NS/c1-6-20-17-11-12-19(4,5)13-18(17)21-16-9-7-15(8-10-16)14(2)3/h7-10,14,17-18,20H,6,11-13H2,1-5H3 |
| InChIKey | DOUXYZGNJFVFRA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine?
The IUPAC name of N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine (CID 64622047) is N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine.
What is the SMILES notation for N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine?
The canonical SMILES for N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine is CCNC1CCC(C)(C)CC1Sc1ccc(C(C)C)cc1.
What is the InChIKey of N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine?
The InChIKey is DOUXYZGNJFVFRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NS/c1-6-20-17-11-12-19(4,5)13-18(17)21-16-9-7-15(8-10-16)14(2)3/h7-10,14,17-18,20H,6,11-13H2,1-5H3.
What are the key properties of N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine?
N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine has a molecular weight of 305.53 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4-dimethyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexan-1-amine is sourced from PubChem (CID 64622047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).