C16H18ClNOS — CID 64622119
2-(4-chlorophenyl)sulfanyl-1-(2-methoxy-5-methylphenyl)ethanamine (PubChem CID 64622119) has the molecular formula C16H18ClNOS and a molecular weight of 307.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-(2-methoxy-5-methylphenyl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-(2-methoxy-5-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 64622119 |
| Molecular Formula | C16H18ClNOS |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-(2-methoxy-5-methylphenyl)ethanamine |
| SMILES | COc1ccc(C)cc1C(N)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNOS/c1-11-3-8-16(19-2)14(9-11)15(18)10-20-13-6-4-12(17)5-7-13/h3-9,15H,10,18H2,1-2H3 |
| InChIKey | HFWUNJVSAPHVCY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |