About 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide
3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide (PubChem CID 64622442) has the molecular formula C8H13BrN4OS
and a molecular weight of 293.19 g/mol. Its IUPAC name is 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide.
Molecular Properties
| Compound Name | 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide |
| PubChem CID | 64622442 |
| Molecular Formula | C8H13BrN4OS |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1nnc(Br)s1 |
| InChI | InChI=1S/C8H13BrN4OS/c1-2-4-10-6(14)3-5-11-8-13-12-7(9)15-8/h2-5H2,1H3,(H,10,14)(H,11,13) |
| InChIKey | ZKKRFMZJMWRGTO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide?
The IUPAC name of 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide (CID 64622442) is 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide.
What is the SMILES notation for 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide?
The canonical SMILES for 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide is CCCNC(=O)CCNc1nnc(Br)s1.
What is the InChIKey of 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide?
The InChIKey is ZKKRFMZJMWRGTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN4OS/c1-2-4-10-6(14)3-5-11-8-13-12-7(9)15-8/h2-5H2,1H3,(H,10,14)(H,11,13).
What are the key properties of 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide?
3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide has a molecular weight of 293.19 g/mol, XLogP of 1.63, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-propylpropanamide is sourced from PubChem (CID 64622442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).