About 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol
1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol (PubChem CID 64622447) has the molecular formula C6H10BrN3OS
and a molecular weight of 252.14 g/mol. Its IUPAC name is 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol |
| PubChem CID | 64622447 |
| Molecular Formula | C6H10BrN3OS |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)c1nnc(Br)s1 |
| InChI | InChI=1S/C6H10BrN3OS/c1-4(11)3-10(2)6-9-8-5(7)12-6/h4,11H,3H2,1-2H3 |
| InChIKey | OHYCNXKRZXORJY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol?
The IUPAC name of 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol (CID 64622447) is 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol.
What is the SMILES notation for 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol?
The canonical SMILES for 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol is CC(O)CN(C)c1nnc(Br)s1.
What is the InChIKey of 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol?
The InChIKey is OHYCNXKRZXORJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrN3OS/c1-4(11)3-10(2)6-9-8-5(7)12-6/h4,11H,3H2,1-2H3.
What are the key properties of 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol?
1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol has a molecular weight of 252.14 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromo-1,3,4-thiadiazol-2-yl)-methylamino]propan-2-ol is sourced from PubChem (CID 64622447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).