About 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid
4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid (PubChem CID 64622512) has the molecular formula C11H7N5O2S
and a molecular weight of 273.28 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid |
| PubChem CID | 64622512 |
| Molecular Formula | C11H7N5O2S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid |
| SMILES | O=C(O)c1nnc2ccccc2c1Sc1ncn[nH]1 |
| InChI | InChI=1S/C11H7N5O2S/c17-10(18)8-9(19-11-12-5-13-16-11)6-3-1-2-4-7(6)14-15-8/h1-5H,(H,17,18)(H,12,13,16) |
| InChIKey | DJHCTKUIALHKNZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid?
The IUPAC name of 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid (CID 64622512) is 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid.
What is the SMILES notation for 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid?
The canonical SMILES for 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid is O=C(O)c1nnc2ccccc2c1Sc1ncn[nH]1.
What is the InChIKey of 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid?
The InChIKey is DJHCTKUIALHKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O2S/c17-10(18)8-9(19-11-12-5-13-16-11)6-3-1-2-4-7(6)14-15-8/h1-5H,(H,17,18)(H,12,13,16).
What are the key properties of 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid?
4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid has a molecular weight of 273.28 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-1,2,4-triazol-5-ylsulfanyl)cinnoline-3-carboxylic acid is sourced from PubChem (CID 64622512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).