C10H10BrN3OS — CID 64622633
5-bromo-N-[(3-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 64622633) has the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. Its IUPAC name is 5-bromo-N-[(3-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-[(3-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 64622633 |
| Molecular Formula | C10H10BrN3OS |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 5-bromo-N-[(3-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cccc(CNc2nnc(Br)s2)c1 |
| InChI | InChI=1S/C10H10BrN3OS/c1-15-8-4-2-3-7(5-8)6-12-10-14-13-9(11)16-10/h2-5H,6H2,1H3,(H,12,14) |
| InChIKey | DDKMXPCNTISVOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |