C14H17N3O2S — CID 64622920
4-[(2-methyl-3-methylsulfanylpropyl)amino]cinnoline-3-carboxylic acid (PubChem CID 64622920) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-[(2-methyl-3-methylsulfanylpropyl)amino]cinnoline-3-carboxylic acid.
| Compound Name | 4-[(2-methyl-3-methylsulfanylpropyl)amino]cinnoline-3-carboxylic acid |
|---|---|
| PubChem CID | 64622920 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[(2-methyl-3-methylsulfanylpropyl)amino]cinnoline-3-carboxylic acid |
| SMILES | CSCC(C)CNc1c(C(=O)O)nnc2ccccc12 |
| InChI | InChI=1S/C14H17N3O2S/c1-9(8-20-2)7-15-12-10-5-3-4-6-11(10)16-17-13(12)14(18)19/h3-6,9H,7-8H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | UAJAATRYUIAFNN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |