About 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide
2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide (PubChem CID 64623269) has the molecular formula C6H9BrN4OS
and a molecular weight of 265.14 g/mol. Its IUPAC name is 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide.
Molecular Properties
| Compound Name | 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide |
| PubChem CID | 64623269 |
| Molecular Formula | C6H9BrN4OS |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)Nc1nnc(Br)s1 |
| InChI | InChI=1S/C6H9BrN4OS/c1-3(4(12)8-2)9-6-11-10-5(7)13-6/h3H,1-2H3,(H,8,12)(H,9,11) |
| InChIKey | SWXLLJKUPIBTSK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide?
The IUPAC name of 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide (CID 64623269) is 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide.
What is the SMILES notation for 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide?
The canonical SMILES for 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide is CNC(=O)C(C)Nc1nnc(Br)s1.
What is the InChIKey of 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide?
The InChIKey is SWXLLJKUPIBTSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN4OS/c1-3(4(12)8-2)9-6-11-10-5(7)13-6/h3H,1-2H3,(H,8,12)(H,9,11).
What are the key properties of 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide?
2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide has a molecular weight of 265.14 g/mol, XLogP of 0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-1,3,4-thiadiazol-2-yl)amino]-N-methylpropanamide is sourced from PubChem (CID 64623269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).