About 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole
2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole (PubChem CID 64623510) has the molecular formula C5H3BrN4S
and a molecular weight of 231.08 g/mol. Its IUPAC name is 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole |
| PubChem CID | 64623510 |
| Molecular Formula | C5H3BrN4S |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 229.93 |
| IUPAC Name | 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole |
| SMILES | Brc1nnc(-n2cccn2)s1 |
| InChI | InChI=1S/C5H3BrN4S/c6-4-8-9-5(11-4)10-3-1-2-7-10/h1-3H |
| InChIKey | NJHXFYDEFCQLTE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole?
The IUPAC name of 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole (CID 64623510) is 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole.
What is the SMILES notation for 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole?
The canonical SMILES for 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole is Brc1nnc(-n2cccn2)s1.
What is the InChIKey of 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole?
The InChIKey is NJHXFYDEFCQLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrN4S/c6-4-8-9-5(11-4)10-3-1-2-7-10/h1-3H.
What are the key properties of 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole?
2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole has a molecular weight of 231.08 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-pyrazol-1-yl-1,3,4-thiadiazole is sourced from PubChem (CID 64623510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).