About 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine
5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 64623881) has the molecular formula C6H8BrN3S
and a molecular weight of 234.12 g/mol. Its IUPAC name is 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 64623881 |
| Molecular Formula | C6H8BrN3S |
| Molecular Weight | 234.12 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(c1nnc(Br)s1)C1CC1 |
| InChI | InChI=1S/C6H8BrN3S/c1-10(4-2-3-4)6-9-8-5(7)11-6/h4H,2-3H2,1H3 |
| InChIKey | DXRUBNWQPDXESP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.12 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine (CID 64623881) is 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine is CN(c1nnc(Br)s1)C1CC1.
What is the InChIKey of 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine?
The InChIKey is DXRUBNWQPDXESP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3S/c1-10(4-2-3-4)6-9-8-5(7)11-6/h4H,2-3H2,1H3.
What are the key properties of 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine?
5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine has a molecular weight of 234.12 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 64623881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).