About 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine
5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 64623888) has the molecular formula C8H14BrN3S
and a molecular weight of 264.19 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 64623888 |
| Molecular Formula | C8H14BrN3S |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)C(C)N(C)c1nnc(Br)s1 |
| InChI | InChI=1S/C8H14BrN3S/c1-5(2)6(3)12(4)8-11-10-7(9)13-8/h5-6H,1-4H3 |
| InChIKey | GRKWRIRVZYIIOY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine (CID 64623888) is 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine is CC(C)C(C)N(C)c1nnc(Br)s1.
What is the InChIKey of 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine?
The InChIKey is GRKWRIRVZYIIOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BrN3S/c1-5(2)6(3)12(4)8-11-10-7(9)13-8/h5-6H,1-4H3.
What are the key properties of 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine?
5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine has a molecular weight of 264.19 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-methyl-N-(3-methylbutan-2-yl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 64623888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).