About 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane
4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane (PubChem CID 64624310) has the molecular formula C7H10BrN3S2
and a molecular weight of 280.22 g/mol. Its IUPAC name is 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane |
| PubChem CID | 64624310 |
| Molecular Formula | C7H10BrN3S2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane |
| SMILES | Brc1nnc(N2CCCSCC2)s1 |
| InChI | InChI=1S/C7H10BrN3S2/c8-6-9-10-7(13-6)11-2-1-4-12-5-3-11/h1-5H2 |
| InChIKey | MVUOOIQYRYMHNO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane?
The IUPAC name of 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane (CID 64624310) is 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane.
What is the SMILES notation for 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane?
The canonical SMILES for 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane is Brc1nnc(N2CCCSCC2)s1.
What is the InChIKey of 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane?
The InChIKey is MVUOOIQYRYMHNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN3S2/c8-6-9-10-7(13-6)11-2-1-4-12-5-3-11/h1-5H2.
What are the key properties of 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane?
4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane has a molecular weight of 280.22 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-1,3,4-thiadiazol-2-yl)-1,4-thiazepane is sourced from PubChem (CID 64624310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).