C8H4BrN3O3S — CID 64624692
2-bromo-5-(3-nitrophenoxy)-1,3,4-thiadiazole (PubChem CID 64624692) has the molecular formula C8H4BrN3O3S and a molecular weight of 302.11 g/mol. Its IUPAC name is 2-bromo-5-(3-nitrophenoxy)-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-(3-nitrophenoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 64624692 |
| Molecular Formula | C8H4BrN3O3S |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.92 |
| IUPAC Name | 2-bromo-5-(3-nitrophenoxy)-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1cccc(Oc2nnc(Br)s2)c1 |
| InChI | InChI=1S/C8H4BrN3O3S/c9-7-10-11-8(16-7)15-6-3-1-2-5(4-6)12(13)14/h1-4H |
| InChIKey | KFBGPQSOZCOQGY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|