C17H29NO2 — CID 64624848
1-(cycloheptylamino)-3-cyclopropylcyclohexane-1-carboxylic acid (PubChem CID 64624848) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-(cycloheptylamino)-3-cyclopropylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(cycloheptylamino)-3-cyclopropylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 64624848 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-(cycloheptylamino)-3-cyclopropylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(NC2CCCCCC2)CCCC(C2CC2)C1 |
| InChI | InChI=1S/C17H29NO2/c19-16(20)17(18-15-7-3-1-2-4-8-15)11-5-6-14(12-17)13-9-10-13/h13-15,18H,1-12H2,(H,19,20) |
| InChIKey | WRYGKFKEHSEZTK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |