C15H19N3S — CID 64626826
2-pyrazin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanamine (PubChem CID 64626826) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-pyrazin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanamine.
| Compound Name | 2-pyrazin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 64626826 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-pyrazin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)CSc2cnccn2)c(C)c1 |
| InChI | InChI=1S/C15H19N3S/c1-10-6-11(2)15(12(3)7-10)13(16)9-19-14-8-17-4-5-18-14/h4-8,13H,9,16H2,1-3H3 |
| InChIKey | URWBGPCPOKULKC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |