C15H25N3S — CID 64627044
4-ethyl-N-propyl-2-pyrimidin-4-ylsulfanylcyclohexan-1-amine (PubChem CID 64627044) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-ethyl-N-propyl-2-pyrimidin-4-ylsulfanylcyclohexan-1-amine.
| Compound Name | 4-ethyl-N-propyl-2-pyrimidin-4-ylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64627044 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-ethyl-N-propyl-2-pyrimidin-4-ylsulfanylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CC)CC1Sc1ccncn1 |
| InChI | InChI=1S/C15H25N3S/c1-3-8-17-13-6-5-12(4-2)10-14(13)19-15-7-9-16-11-18-15/h7,9,11-14,17H,3-6,8,10H2,1-2H3 |
| InChIKey | SHFCDCYYXZJDAC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |