C17H11N3O — CID 6462835
5-naphthalen-2-yl-3-pyridin-3-yl-1,2,4-oxadiazole (PubChem CID 6462835) has the molecular formula C17H11N3O and a molecular weight of 273.30 g/mol. Its IUPAC name is 5-naphthalen-2-yl-3-pyridin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-naphthalen-2-yl-3-pyridin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 6462835 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-naphthalen-2-yl-3-pyridin-3-yl-1,2,4-oxadiazole |
| SMILES | c1cncc(-c2noc(-c3ccc4ccccc4c3)n2)c1 |
| InChI | InChI=1S/C17H11N3O/c1-2-5-13-10-14(8-7-12(13)4-1)17-19-16(20-21-17)15-6-3-9-18-11-15/h1-11H |
| InChIKey | TVVPNYVYLPHGEZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |