About 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile
2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile (PubChem CID 6462949) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile |
| PubChem CID | 6462949 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile |
| SMILES | Cc1nnc(SCc2ccccc2C#N)o1 |
| InChI | InChI=1S/C11H9N3OS/c1-8-13-14-11(15-8)16-7-10-5-3-2-4-9(10)6-12/h2-5H,7H2,1H3 |
| InChIKey | ANOOHGPEBRQTKZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile?
The IUPAC name of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile (CID 6462949) is 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile.
What is the SMILES notation for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile?
The canonical SMILES for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile is Cc1nnc(SCc2ccccc2C#N)o1.
What is the InChIKey of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile?
The InChIKey is ANOOHGPEBRQTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3OS/c1-8-13-14-11(15-8)16-7-10-5-3-2-4-9(10)6-12/h2-5H,7H2,1H3.
What are the key properties of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile?
2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile has a molecular weight of 231.28 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile is sourced from PubChem (CID 6462949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).